C37H16OS12 — CID 102098071
2-[2,3,4,5-tetrakis(1,3-benzodithiol-2-ylidene)cyclopentylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-one (PubChem CID 102098071) has the molecular formula C37H16OS12 and a molecular weight of 861.34 g/mol. Its IUPAC name is 2-[2,3,4,5-tetrakis(1,3-benzodithiol-2-ylidene)cyclopentylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-one.
| Compound Name | 2-[2,3,4,5-tetrakis(1,3-benzodithiol-2-ylidene)cyclopentylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-one |
|---|---|
| PubChem CID | 102098071 |
| Molecular Formula | C37H16OS12 |
| Molecular Weight | 861.34 g/mol |
| Exact Mass | 859.78 |
| IUPAC Name | 2-[2,3,4,5-tetrakis(1,3-benzodithiol-2-ylidene)cyclopentylidene]-[1,3]dithiolo[4,5-d][1,3]dithiol-5-one |
| SMILES | O=c1sc2c(s1)SC(=C1C(=C3Sc4ccccc4S3)C(=C3Sc4ccccc4S3)C(=C3Sc4ccccc4S3)C1=C1Sc3ccccc3S1)S2 |
| InChI | InChI=1S/C37H16OS12/c38-37-49-35-36(50-37)48-34(47-35)29-27(32-43-21-13-5-6-14-22(21)44-32)25(30-39-17-9-1-2-10-18(17)40-30)26(31-41-19-11-3-4-12-20(19)42-31)28(29)33-45-23-15-7-8-16-24(23)46-33/h1-16H |
| InChIKey | HFUDYJKLBPTCAI-UHFFFAOYSA-N |
| XLogP | 15.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.34 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |