About 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol
2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol (PubChem CID 102099089) has the molecular formula C5H8N8O7
and a molecular weight of 292.17 g/mol. Its IUPAC name is 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol |
| PubChem CID | 102099089 |
| Molecular Formula | C5H8N8O7 |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol |
| SMILES | O=[N+]([O-])C(CNc1nnnn1CCO)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C5H8N8O7/c14-2-1-10-4(7-8-9-10)6-3-5(11(15)16,12(17)18)13(19)20/h14H,1-3H2,(H,6,7,9) |
| InChIKey | LUCRCKOPEXFEQC-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 205.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol?
The IUPAC name of 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol (CID 102099089) is 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol.
What is the SMILES notation for 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol?
The canonical SMILES for 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol is O=[N+]([O-])C(CNc1nnnn1CCO)([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol?
The InChIKey is LUCRCKOPEXFEQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N8O7/c14-2-1-10-4(7-8-9-10)6-3-5(11(15)16,12(17)18)13(19)20/h14H,1-3H2,(H,6,7,9).
What are the key properties of 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol?
2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol has a molecular weight of 292.17 g/mol, XLogP of -2.44, 8 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,2,2-trinitroethylamino)tetrazol-1-yl]ethanol is sourced from PubChem (CID 102099089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).