About 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole
1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole (PubChem CID 102099566) has the molecular formula C29H24N2O2S
and a molecular weight of 464.59 g/mol. Its IUPAC name is 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole.
Molecular Properties
| Compound Name | 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole |
| PubChem CID | 102099566 |
| Molecular Formula | C29H24N2O2S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole |
| SMILES | Cc1ccc(S(=O)(=O)c2c(-c3ccccc3)nn(Cc3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24N2O2S/c1-22-17-19-26(20-18-22)34(32,33)29-27(24-13-7-3-8-14-24)30-31(21-23-11-5-2-6-12-23)28(29)25-15-9-4-10-16-25/h2-20H,21H2,1H3 |
| InChIKey | UGRWJQPNWAHXMD-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole?
The IUPAC name of 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole (CID 102099566) is 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole.
What is the SMILES notation for 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole?
The canonical SMILES for 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole is Cc1ccc(S(=O)(=O)c2c(-c3ccccc3)nn(Cc3ccccc3)c2-c2ccccc2)cc1.
What is the InChIKey of 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole?
The InChIKey is UGRWJQPNWAHXMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H24N2O2S/c1-22-17-19-26(20-18-22)34(32,33)29-27(24-13-7-3-8-14-24)30-31(21-23-11-5-2-6-12-23)28(29)25-15-9-4-10-16-25/h2-20H,21H2,1H3.
What are the key properties of 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole?
1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole has a molecular weight of 464.59 g/mol, XLogP of 6.41, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-(4-methylphenyl)sulfonyl-3,5-diphenylpyrazole is sourced from PubChem (CID 102099566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).