C37H34F34P+ — CID 102100267
(4-ethenylphenyl)methyl-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-(2,4,4-trimethylpentyl)phosphanium (PubChem CID 102100267) has the molecular formula C37H34F34P+ and a molecular weight of 1155.58 g/mol. Its IUPAC name is (4-ethenylphenyl)methyl-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-(2,4,4-trimethylpentyl)phosphanium.
| Compound Name | (4-ethenylphenyl)methyl-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-(2,4,4-trimethylpentyl)phosphanium |
|---|---|
| PubChem CID | 102100267 |
| Molecular Formula | C37H34F34P+ |
| Molecular Weight | 1155.58 g/mol |
| Exact Mass | 1155.18 |
| IUPAC Name | (4-ethenylphenyl)methyl-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-(2,4,4-trimethylpentyl)phosphanium |
| SMILES | C=Cc1ccc(C[P+](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C37H34F34P/c1-6-19-7-9-20(10-8-19)17-72(16-18(2)15-21(3,4)5,13-11-22(38,39)24(42,43)26(46,47)28(50,51)30(54,55)32(58,59)34(62,63)36(66,67)68)14-12-23(40,41)25(44,45)27(48,49)29(52,53)31(56,57)33(60,61)35(64,65)37(69,70)71/h6-10,18H,1,11-17H2,2-5H3/q+1 |
| InChIKey | IZYLOWFLECYJCN-UHFFFAOYSA-N |
| XLogP | 17.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1155.58 |
| LogP ≤ 5 | 17.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|