C17H24O3 — CID 102100747
(5S)-7,9-ditert-butyl-1-oxaspiro[4.5]deca-7,9-diene-2,6-dione (PubChem CID 102100747) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (5S)-7,9-ditert-butyl-1-oxaspiro[4.5]deca-7,9-diene-2,6-dione.
| Compound Name | (5S)-7,9-ditert-butyl-1-oxaspiro[4.5]deca-7,9-diene-2,6-dione |
|---|---|
| PubChem CID | 102100747 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (5S)-7,9-ditert-butyl-1-oxaspiro[4.5]deca-7,9-diene-2,6-dione |
| SMILES | CC(C)(C)C1=C[C@@]2(CCC(=O)O2)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C17H24O3/c1-15(2,3)11-9-12(16(4,5)6)14(19)17(10-11)8-7-13(18)20-17/h9-10H,7-8H2,1-6H3/t17-/m0/s1 |
| InChIKey | ZQQIOPIVOQERNV-KRWDZBQOSA-N |
| XLogP | 3.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |