C30H44F3NO6 — CID 10210097
[8-[7-(cyclopropylamino)-3-hydroxy-7-oxo-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 10210097) has the molecular formula C30H44F3NO6 and a molecular weight of 571.68 g/mol. Its IUPAC name is [8-[7-(cyclopropylamino)-3-hydroxy-7-oxo-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [8-[7-(cyclopropylamino)-3-hydroxy-7-oxo-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 10210097 |
| Molecular Formula | C30H44F3NO6 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | [8-[7-(cyclopropylamino)-3-hydroxy-7-oxo-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC(O)CC(CC(=O)NC3CC3)OC(=O)C(F)(F)F)C21 |
| InChI | InChI=1S/C30H44F3NO6/c1-6-29(4,5)27(37)40-24-14-17(2)13-19-8-7-18(3)23(26(19)24)12-11-21(35)15-22(39-28(38)30(31,32)33)16-25(36)34-20-9-10-20/h7-8,13,17-18,20-24,26,35H,6,9-12,14-16H2,1-5H3,(H,34,36) |
| InChIKey | XUCZKTOEUKGSHE-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |