About trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine
trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine (PubChem CID 102101183) has the molecular formula C9H9F6NS
and a molecular weight of 277.23 g/mol. Its IUPAC name is trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine |
| PubChem CID | 102101183 |
| Molecular Formula | C9H9F6NS |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine |
| SMILES | N[C@H]1C[C@]1(F)c1ccc(S(F)(F)(F)(F)F)cc1 |
| InChI | InChI=1S/C9H9F6NS/c10-9(5-8(9)16)6-1-3-7(4-2-6)17(11,12,13,14)15/h1-4,8H,5,16H2/t8-,9-/m0/s1 |
| InChIKey | KMZXDKFYIFLKNO-IUCAKERBSA-N |
| XLogP | 4.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine?
The IUPAC name of trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine (CID 102101183) is trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine.
What is the SMILES notation for trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine?
The canonical SMILES for trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine is N[C@H]1C[C@]1(F)c1ccc(S(F)(F)(F)(F)F)cc1.
What is the InChIKey of trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine?
The InChIKey is KMZXDKFYIFLKNO-IUCAKERBSA-N. The full InChI is InChI=1S/C9H9F6NS/c10-9(5-8(9)16)6-1-3-7(4-2-6)17(11,12,13,14)15/h1-4,8H,5,16H2/t8-,9-/m0/s1.
What are the key properties of trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine?
trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine has a molecular weight of 277.23 g/mol, XLogP of 4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-2-fluoro-2-[4-(pentafluoro-λ6-sulfanyl)phenyl]cyclopropan-1-amine is sourced from PubChem (CID 102101183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).