C22H26F3N7O6S — CID 10210148
(2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[[2-nitro-4-(trifluoromethyl)phenyl]sulfonylamino]pentanamide (PubChem CID 10210148) has the molecular formula C22H26F3N7O6S and a molecular weight of 573.55 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[[2-nitro-4-(trifluoromethyl)phenyl]sulfonylamino]pentanamide.
| Compound Name | (2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[[2-nitro-4-(trifluoromethyl)phenyl]sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 10210148 |
| Molecular Formula | C22H26F3N7O6S |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | (2S)-N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)-2-[[2-nitro-4-(trifluoromethyl)phenyl]sulfonylamino]pentanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26F3N7O6S/c23-22(24,25)14-8-9-18(17(12-14)32(35)36)39(37,38)31-15(7-4-10-29-21(27)28)20(34)30-16(19(26)33)11-13-5-2-1-3-6-13/h1-3,5-6,8-9,12,15-16,31H,4,7,10-11H2,(H2,26,33)(H,30,34)(H4,27,28,29)/t15-,16-/m0/s1 |
| InChIKey | JHCHSFSBQYFVRS-HOTGVXAUSA-N |
| XLogP | 0.53 |
| TPSA | 225.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|