C35H25FO4 — CID 102101724
3-(4-fluorophenyl)-5-phenyl-2-[(E)-3-phenylprop-2-enoyl]spiro[cyclohexane-4,2'-indene]-1,1',3'-trione (PubChem CID 102101724) has the molecular formula C35H25FO4 and a molecular weight of 528.58 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-phenyl-2-[(E)-3-phenylprop-2-enoyl]spiro[cyclohexane-4,2'-indene]-1,1',3'-trione.
| Compound Name | 3-(4-fluorophenyl)-5-phenyl-2-[(E)-3-phenylprop-2-enoyl]spiro[cyclohexane-4,2'-indene]-1,1',3'-trione |
|---|---|
| PubChem CID | 102101724 |
| Molecular Formula | C35H25FO4 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 3-(4-fluorophenyl)-5-phenyl-2-[(E)-3-phenylprop-2-enoyl]spiro[cyclohexane-4,2'-indene]-1,1',3'-trione |
| SMILES | O=C(/C=C/c1ccccc1)C1C(=O)CC(c2ccccc2)C2(C(=O)c3ccccc3C2=O)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C35H25FO4/c36-25-18-16-24(17-19-25)32-31(29(37)20-15-22-9-3-1-4-10-22)30(38)21-28(23-11-5-2-6-12-23)35(32)33(39)26-13-7-8-14-27(26)34(35)40/h1-20,28,31-32H,21H2/b20-15+ |
| InChIKey | FDFZKPSDHMNIIN-HMMYKYKNSA-N |
| XLogP | 6.63 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|