C29H21ClO4 — CID 102101731
2-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-3-phenylspiro[cyclohexane-4,2'-indene]-1,1',3'-trione (PubChem CID 102101731) has the molecular formula C29H21ClO4 and a molecular weight of 468.94 g/mol. Its IUPAC name is 2-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-3-phenylspiro[cyclohexane-4,2'-indene]-1,1',3'-trione.
| Compound Name | 2-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-3-phenylspiro[cyclohexane-4,2'-indene]-1,1',3'-trione |
|---|---|
| PubChem CID | 102101731 |
| Molecular Formula | C29H21ClO4 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2-[(E)-3-(4-chlorophenyl)prop-2-enoyl]-3-phenylspiro[cyclohexane-4,2'-indene]-1,1',3'-trione |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)C1C(=O)CCC2(C(=O)c3ccccc3C2=O)C1c1ccccc1 |
| InChI | InChI=1S/C29H21ClO4/c30-20-13-10-18(11-14-20)12-15-23(31)25-24(32)16-17-29(26(25)19-6-2-1-3-7-19)27(33)21-8-4-5-9-22(21)28(29)34/h1-15,25-26H,16-17H2/b15-12+ |
| InChIKey | IEVSBUPHYOTZGK-NTCAYCPXSA-N |
| XLogP | 5.75 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|