C28H28O14 — CID 102101777
heptamethyl pentacyclo[7.5.0.02,4.03,8.05,14]tetradeca-6,10,12-triene-2,3,4,5,6,7,8-heptacarboxylate (PubChem CID 102101777) has the molecular formula C28H28O14 and a molecular weight of 588.52 g/mol. Its IUPAC name is heptamethyl pentacyclo[7.5.0.02,4.03,8.05,14]tetradeca-6,10,12-triene-2,3,4,5,6,7,8-heptacarboxylate.
| Compound Name | heptamethyl pentacyclo[7.5.0.02,4.03,8.05,14]tetradeca-6,10,12-triene-2,3,4,5,6,7,8-heptacarboxylate |
|---|---|
| PubChem CID | 102101777 |
| Molecular Formula | C28H28O14 |
| Molecular Weight | 588.52 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | heptamethyl pentacyclo[7.5.0.02,4.03,8.05,14]tetradeca-6,10,12-triene-2,3,4,5,6,7,8-heptacarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C(=O)OC)C3C=CC=CC4C3C3(C(=O)OC)C(C(=O)OC)(C14C(=O)OC)C23C(=O)OC |
| InChI | InChI=1S/C28H28O14/c1-36-17(29)15-16(18(30)37-2)25(20(32)39-4)13-11-9-8-10-12-14(13)26(21(33)40-5)27(22(34)41-6,24(12,15)19(31)38-3)28(25,26)23(35)42-7/h8-14H,1-7H3 |
| InChIKey | AELQWBZEYICRML-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 184.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.52 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|