About propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate
propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate (PubChem CID 102102366) has the molecular formula C17H26N2O5
and a molecular weight of 338.40 g/mol. Its IUPAC name is propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate.
Molecular Properties
| Compound Name | propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate |
| PubChem CID | 102102366 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate |
| SMILES | Cc1cc(N(NC(=O)OC(C)C)C(=O)OC(C)C)c(C)c(C)c1O |
| InChI | InChI=1S/C17H26N2O5/c1-9(2)23-16(21)18-19(17(22)24-10(3)4)14-8-11(5)15(20)13(7)12(14)6/h8-10,20H,1-7H3,(H,18,21) |
| InChIKey | ATCWDEHNSFQNOS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate?
The IUPAC name of propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate (CID 102102366) is propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate.
What is the SMILES notation for propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate?
The canonical SMILES for propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate is Cc1cc(N(NC(=O)OC(C)C)C(=O)OC(C)C)c(C)c(C)c1O.
What is the InChIKey of propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate?
The InChIKey is ATCWDEHNSFQNOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O5/c1-9(2)23-16(21)18-19(17(22)24-10(3)4)14-8-11(5)15(20)13(7)12(14)6/h8-10,20H,1-7H3,(H,18,21).
What are the key properties of propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate?
propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate has a molecular weight of 338.40 g/mol, XLogP of 3.72, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-(4-hydroxy-2,3,5-trimethylphenyl)-N-(propan-2-yloxycarbonylamino)carbamate is sourced from PubChem (CID 102102366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).