About 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol
3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol (PubChem CID 102102664) has the molecular formula C12H5Br5O2
and a molecular weight of 580.69 g/mol. Its IUPAC name is 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol.
Molecular Properties
| Compound Name | 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol |
| PubChem CID | 102102664 |
| Molecular Formula | C12H5Br5O2 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 575.62 |
| IUPAC Name | 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol |
| SMILES | Oc1cc(Br)cc(Br)c1Oc1cc(Br)cc(Br)c1Br |
| InChI | InChI=1S/C12H5Br5O2/c13-5-2-8(16)12(9(18)3-5)19-10-4-6(14)1-7(15)11(10)17/h1-4,18H |
| InChIKey | LNZBRHBHVLZPKZ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol?
The IUPAC name of 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol (CID 102102664) is 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol.
What is the SMILES notation for 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol?
The canonical SMILES for 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol is Oc1cc(Br)cc(Br)c1Oc1cc(Br)cc(Br)c1Br.
What is the InChIKey of 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol?
The InChIKey is LNZBRHBHVLZPKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5Br5O2/c13-5-2-8(16)12(9(18)3-5)19-10-4-6(14)1-7(15)11(10)17/h1-4,18H.
What are the key properties of 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol?
3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol has a molecular weight of 580.69 g/mol, XLogP of 7.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-2-(2,3,5-tribromophenoxy)phenol is sourced from PubChem (CID 102102664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).