C14H15F5O3Si — CID 102102674
methyl 2-(2,3,4,5,6-pentafluorophenyl)-2-trimethylsilyloxycyclopropane-1-carboxylate (PubChem CID 102102674) has the molecular formula C14H15F5O3Si and a molecular weight of 354.35 g/mol. Its IUPAC name is methyl 2-(2,3,4,5,6-pentafluorophenyl)-2-trimethylsilyloxycyclopropane-1-carboxylate.
| Compound Name | methyl 2-(2,3,4,5,6-pentafluorophenyl)-2-trimethylsilyloxycyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102102674 |
| Molecular Formula | C14H15F5O3Si |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | methyl 2-(2,3,4,5,6-pentafluorophenyl)-2-trimethylsilyloxycyclopropane-1-carboxylate |
| SMILES | COC(=O)C1CC1(O[Si](C)(C)C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H15F5O3Si/c1-21-13(20)6-5-14(6,22-23(2,3)4)7-8(15)10(17)12(19)11(18)9(7)16/h6H,5H2,1-4H3 |
| InChIKey | ZAWBBLNNADOVPJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|