C29H11BF15NO — CID 102102874
[[methyl(prop-2-ynyl)azaniumylidene]-phenylmethoxy]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 102102874) has the molecular formula C29H11BF15NO and a molecular weight of 685.20 g/mol. Its IUPAC name is [[methyl(prop-2-ynyl)azaniumylidene]-phenylmethoxy]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [[methyl(prop-2-ynyl)azaniumylidene]-phenylmethoxy]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 102102874 |
| Molecular Formula | C29H11BF15NO |
| Molecular Weight | 685.20 g/mol |
| Exact Mass | 685.07 |
| IUPAC Name | [[methyl(prop-2-ynyl)azaniumylidene]-phenylmethoxy]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | C#CC/[N+](C)=C(/O[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C29H11BF15NO/c1-3-9-46(2)29(10-7-5-4-6-8-10)47-30(11-14(31)20(37)26(43)21(38)15(11)32,12-16(33)22(39)27(44)23(40)17(12)34)13-18(35)24(41)28(45)25(42)19(13)36/h1,4-8H,9H2,2H3/b46-29+ |
| InChIKey | NNLIRCHJMAFASF-ZHZMQRCZSA-N |
| XLogP | 5.48 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.20 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|