C30H48O7Si2 — CID 102103067
6-[tert-butyl(dimethyl)silyl]oxy-6-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)hexane-2,4-dione (PubChem CID 102103067) has the molecular formula C30H48O7Si2 and a molecular weight of 576.88 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-6-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)hexane-2,4-dione.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-6-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)hexane-2,4-dione |
|---|---|
| PubChem CID | 102103067 |
| Molecular Formula | C30H48O7Si2 |
| Molecular Weight | 576.88 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-6-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1-(2,2-dimethyl-6-oxo-1,3-dioxin-4-yl)hexane-2,4-dione |
| SMILES | CC1(C)OC(=O)C=C(CC(=O)CC(=O)CC(O[Si](C)(C)C(C)(C)C)c2ccc(O[Si](C)(C)C(C)(C)C)cc2)O1 |
| InChI | InChI=1S/C30H48O7Si2/c1-28(2,3)38(9,10)36-24-15-13-21(14-16-24)26(37-39(11,12)29(4,5)6)19-23(32)17-22(31)18-25-20-27(33)35-30(7,8)34-25/h13-16,20,26H,17-19H2,1-12H3 |
| InChIKey | UPTVAXWMKUNBMF-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.88 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|