C35H42ClNO2Si — CID 102104107
(2E,6E)-1-(4-chlorophenyl)-8-[(2R)-2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-yl]-6-methylocta-2,6-dien-1-one (PubChem CID 102104107) has the molecular formula C35H42ClNO2Si and a molecular weight of 572.27 g/mol. Its IUPAC name is (2E,6E)-1-(4-chlorophenyl)-8-[(2R)-2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-yl]-6-methylocta-2,6-dien-1-one.
| Compound Name | (2E,6E)-1-(4-chlorophenyl)-8-[(2R)-2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-yl]-6-methylocta-2,6-dien-1-one |
|---|---|
| PubChem CID | 102104107 |
| Molecular Formula | C35H42ClNO2Si |
| Molecular Weight | 572.27 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | (2E,6E)-1-(4-chlorophenyl)-8-[(2R)-2-[diphenyl(trimethylsilyloxy)methyl]pyrrolidin-1-yl]-6-methylocta-2,6-dien-1-one |
| SMILES | C/C(=C\CN1CCC[C@@H]1C(O[Si](C)(C)C)(c1ccccc1)c1ccccc1)CC/C=C/C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C35H42ClNO2Si/c1-28(14-11-12-19-33(38)29-21-23-32(36)24-22-29)25-27-37-26-13-20-34(37)35(39-40(2,3)4,30-15-7-5-8-16-30)31-17-9-6-10-18-31/h5-10,12,15-19,21-25,34H,11,13-14,20,26-27H2,1-4H3/b19-12+,28-25+/t34-/m1/s1 |
| InChIKey | QWCJSHPRYIWVAZ-QTPZLOSMSA-N |
| XLogP | 9.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.27 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|