About 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one
1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one (PubChem CID 102104201) has the molecular formula C15H12F3N3O
and a molecular weight of 307.28 g/mol. Its IUPAC name is 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one |
| PubChem CID | 102104201 |
| Molecular Formula | C15H12F3N3O |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one |
| SMILES | Cc1cn2c(=O)cc(C(F)(F)F)nc2n1Cc1ccccc1 |
| InChI | InChI=1S/C15H12F3N3O/c1-10-8-21-13(22)7-12(15(16,17)18)19-14(21)20(10)9-11-5-3-2-4-6-11/h2-8H,9H2,1H3 |
| InChIKey | IFZNYSQDTNAODU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one?
The IUPAC name of 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one (CID 102104201) is 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one.
What is the SMILES notation for 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one?
The canonical SMILES for 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one is Cc1cn2c(=O)cc(C(F)(F)F)nc2n1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one?
The InChIKey is IFZNYSQDTNAODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F3N3O/c1-10-8-21-13(22)7-12(15(16,17)18)19-14(21)20(10)9-11-5-3-2-4-6-11/h2-8H,9H2,1H3.
What are the key properties of 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one?
1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one has a molecular weight of 307.28 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-methyl-7-(trifluoromethyl)imidazo[1,2-a]pyrimidin-5-one is sourced from PubChem (CID 102104201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).