C28H34F6N6O — CID 10210442
1-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylethyl]-4-[5-(2H-tetrazol-5-yl)pentyl]piperazine (PubChem CID 10210442) has the molecular formula C28H34F6N6O and a molecular weight of 584.61 g/mol. Its IUPAC name is 1-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylethyl]-4-[5-(2H-tetrazol-5-yl)pentyl]piperazine.
| Compound Name | 1-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylethyl]-4-[5-(2H-tetrazol-5-yl)pentyl]piperazine |
|---|---|
| PubChem CID | 10210442 |
| Molecular Formula | C28H34F6N6O |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 1-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylethyl]-4-[5-(2H-tetrazol-5-yl)pentyl]piperazine |
| SMILES | CC(OCC(c1ccccc1)N1CCN(CCCCCc2nn[nH]n2)CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H34F6N6O/c1-20(22-16-23(27(29,30)31)18-24(17-22)28(32,33)34)41-19-25(21-8-4-2-5-9-21)40-14-12-39(13-15-40)11-7-3-6-10-26-35-37-38-36-26/h2,4-5,8-9,16-18,20,25H,3,6-7,10-15,19H2,1H3,(H,35,36,37,38) |
| InChIKey | CMGWRCKOJTZXBP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|