C12H10P5Se2+ — CID 102104668
7,7-diphenyl-3,5-diselena-1,2,4,6-tetraphospha-7-phosphoniatricyclo[2.2.1.02,6]heptane (PubChem CID 102104668) has the molecular formula C12H10P5Se2+ and a molecular weight of 467.00 g/mol. Its IUPAC name is 7,7-diphenyl-3,5-diselena-1,2,4,6-tetraphospha-7-phosphoniatricyclo[2.2.1.02,6]heptane.
| Compound Name | 7,7-diphenyl-3,5-diselena-1,2,4,6-tetraphospha-7-phosphoniatricyclo[2.2.1.02,6]heptane |
|---|---|
| PubChem CID | 102104668 |
| Molecular Formula | C12H10P5Se2+ |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 468.78 |
| IUPAC Name | 7,7-diphenyl-3,5-diselena-1,2,4,6-tetraphospha-7-phosphoniatricyclo[2.2.1.02,6]heptane |
| SMILES | c1ccc([P+]2(c3ccccc3)p3[se]p4p2p4[se]3)cc1 |
| InChI | InChI=1S/C12H10P5Se2/c1-3-7-11(8-4-1)17(12-9-5-2-6-10-12)13-14-15(13)19-16(17)18-14/h1-10H/q+1 |
| InChIKey | ZSWJUWJTCWPLCL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|