C24H30N2O3 — CID 102105095
2-(3,5-dimethoxyphenyl)-3-(2,4,4-trimethylpentan-2-ylimino)isoindol-1-one (PubChem CID 102105095) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-3-(2,4,4-trimethylpentan-2-ylimino)isoindol-1-one.
| Compound Name | 2-(3,5-dimethoxyphenyl)-3-(2,4,4-trimethylpentan-2-ylimino)isoindol-1-one |
|---|---|
| PubChem CID | 102105095 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-3-(2,4,4-trimethylpentan-2-ylimino)isoindol-1-one |
| SMILES | COc1cc(OC)cc(N2C(=O)c3ccccc3/C2=N\C(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C24H30N2O3/c1-23(2,3)15-24(4,5)25-21-19-10-8-9-11-20(19)22(27)26(21)16-12-17(28-6)14-18(13-16)29-7/h8-14H,15H2,1-7H3/b25-21+ |
| InChIKey | IHMUDYHQXGIFMA-NJNXFGOHSA-N |
| XLogP | 5.33 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|