About methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate
methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate (PubChem CID 102105191) has the molecular formula C21H32F2O3Si
and a molecular weight of 398.57 g/mol. Its IUPAC name is methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate.
Molecular Properties
| Compound Name | methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate |
| PubChem CID | 102105191 |
| Molecular Formula | C21H32F2O3Si |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate |
| SMILES | COC(=O)C(F)(F)/C=C/c1ccccc1CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H32F2O3Si/c1-15(2)27(16(3)4,17(5)6)26-14-19-11-9-8-10-18(19)12-13-21(22,23)20(24)25-7/h8-13,15-17H,14H2,1-7H3/b13-12+ |
| InChIKey | UVYZTRBIGCCVGT-OUKQBFOZSA-N |
| XLogP | 6.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate?
The IUPAC name of methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate (CID 102105191) is methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate.
What is the SMILES notation for methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate?
The canonical SMILES for methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate is COC(=O)C(F)(F)/C=C/c1ccccc1CO[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate?
The InChIKey is UVYZTRBIGCCVGT-OUKQBFOZSA-N. The full InChI is InChI=1S/C21H32F2O3Si/c1-15(2)27(16(3)4,17(5)6)26-14-19-11-9-8-10-18(19)12-13-21(22,23)20(24)25-7/h8-13,15-17H,14H2,1-7H3/b13-12+.
What are the key properties of methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate?
methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate has a molecular weight of 398.57 g/mol, XLogP of 6.20, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2,2-difluoro-4-[2-[tri(propan-2-yl)silyloxymethyl]phenyl]but-3-enoate is sourced from PubChem (CID 102105191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).