C23H21ClN2O5S — CID 1021052
methyl 4-[[2-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]acetyl]amino]benzoate (PubChem CID 1021052) has the molecular formula C23H21ClN2O5S and a molecular weight of 472.95 g/mol. Its IUPAC name is methyl 4-[[2-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 1021052 |
| Molecular Formula | C23H21ClN2O5S |
| Molecular Weight | 472.95 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | methyl 4-[[2-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CN(Cc2ccc(Cl)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21ClN2O5S/c1-31-23(28)18-9-13-20(14-10-18)25-22(27)16-26(15-17-7-11-19(24)12-8-17)32(29,30)21-5-3-2-4-6-21/h2-14H,15-16H2,1H3,(H,25,27) |
| InChIKey | DSGLUDYSDKFYCO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.95 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |