About 3-amino-5-azidobenzoic acid
3-amino-5-azidobenzoic acid (PubChem CID 102105505) has the molecular formula C7H6N4O2
and a molecular weight of 178.15 g/mol. Its IUPAC name is 3-amino-5-azidobenzoic acid.
Molecular Properties
| Compound Name | 3-amino-5-azidobenzoic acid |
| PubChem CID | 102105505 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 3-amino-5-azidobenzoic acid |
| SMILES | [N-]=[N+]=Nc1cc(N)cc(C(=O)O)c1 |
| InChI | InChI=1S/C7H6N4O2/c8-5-1-4(7(12)13)2-6(3-5)10-11-9/h1-3H,8H2,(H,12,13) |
| InChIKey | RGZYYVMADHTJJW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-azidobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-azidobenzoic acid?
The IUPAC name of 3-amino-5-azidobenzoic acid (CID 102105505) is 3-amino-5-azidobenzoic acid.
What is the SMILES notation for 3-amino-5-azidobenzoic acid?
The canonical SMILES for 3-amino-5-azidobenzoic acid is [N-]=[N+]=Nc1cc(N)cc(C(=O)O)c1.
What is the InChIKey of 3-amino-5-azidobenzoic acid?
The InChIKey is RGZYYVMADHTJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O2/c8-5-1-4(7(12)13)2-6(3-5)10-11-9/h1-3H,8H2,(H,12,13).
What are the key properties of 3-amino-5-azidobenzoic acid?
3-amino-5-azidobenzoic acid has a molecular weight of 178.15 g/mol, XLogP of 1.91, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-azidobenzoic acid is sourced from PubChem (CID 102105505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).