C51H30F9N3 — CID 102106377
3,8,13-triphenyl-4,9,14-tris[4-(trifluoromethyl)phenyl]-3,8,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene (PubChem CID 102106377) has the molecular formula C51H30F9N3 and a molecular weight of 855.80 g/mol. Its IUPAC name is 3,8,13-triphenyl-4,9,14-tris[4-(trifluoromethyl)phenyl]-3,8,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene.
| Compound Name | 3,8,13-triphenyl-4,9,14-tris[4-(trifluoromethyl)phenyl]-3,8,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
|---|---|
| PubChem CID | 102106377 |
| Molecular Formula | C51H30F9N3 |
| Molecular Weight | 855.80 g/mol |
| Exact Mass | 855.23 |
| IUPAC Name | 3,8,13-triphenyl-4,9,14-tris[4-(trifluoromethyl)phenyl]-3,8,13-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1,4,6,9,11,14-hexaene |
| SMILES | FC(F)(F)c1ccc(-c2cc3c(c4cc(-c5ccc(C(F)(F)F)cc5)n(-c5ccccc5)c4c4cc(-c5ccc(C(F)(F)F)cc5)n(-c5ccccc5)c34)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C51H30F9N3/c52-49(53,54)34-22-16-31(17-23-34)43-28-40-46(61(43)37-10-4-1-5-11-37)41-29-44(32-18-24-35(25-19-32)50(55,56)57)62(38-12-6-2-7-13-38)48(41)42-30-45(33-20-26-36(27-21-33)51(58,59)60)63(47(40)42)39-14-8-3-9-15-39/h1-30H |
| InChIKey | WOTSJHCRLDWDQF-UHFFFAOYSA-N |
| XLogP | 15.58 |
| TPSA | 14.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.80 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |