About 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine
11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine (PubChem CID 102106575) has the molecular formula C15H15NO
and a molecular weight of 225.29 g/mol. Its IUPAC name is 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine.
Molecular Properties
| Compound Name | 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine |
| PubChem CID | 102106575 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine |
| SMILES | CN1Cc2ccccc2Oc2ccccc2C1 |
| InChI | InChI=1S/C15H15NO/c1-16-10-12-6-2-4-8-14(12)17-15-9-5-3-7-13(15)11-16/h2-9H,10-11H2,1H3 |
| InChIKey | QVLFQUDARGTYKH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine?
The IUPAC name of 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine (CID 102106575) is 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine.
What is the SMILES notation for 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine?
The canonical SMILES for 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine is CN1Cc2ccccc2Oc2ccccc2C1.
What is the InChIKey of 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine?
The InChIKey is QVLFQUDARGTYKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO/c1-16-10-12-6-2-4-8-14(12)17-15-9-5-3-7-13(15)11-16/h2-9H,10-11H2,1H3.
What are the key properties of 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine?
11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine has a molecular weight of 225.29 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyl-10,12-dihydrobenzo[b][1,5]benzoxazocine is sourced from PubChem (CID 102106575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).