About 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol
2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol (PubChem CID 102106626) has the molecular formula C13H9N3O3S
and a molecular weight of 287.30 g/mol. Its IUPAC name is 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol.
Molecular Properties
| Compound Name | 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol |
| PubChem CID | 102106626 |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol |
| SMILES | Nc1ccc(-c2nc3ccc(O)cc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9N3O3S/c14-9-3-1-7(5-11(9)16(18)19)13-15-10-4-2-8(17)6-12(10)20-13/h1-6,17H,14H2 |
| InChIKey | AILSLSVNVFTDCM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol?
The IUPAC name of 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol (CID 102106626) is 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol.
What is the SMILES notation for 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol?
The canonical SMILES for 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol is Nc1ccc(-c2nc3ccc(O)cc3s2)cc1[N+](=O)[O-].
What is the InChIKey of 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol?
The InChIKey is AILSLSVNVFTDCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O3S/c14-9-3-1-7(5-11(9)16(18)19)13-15-10-4-2-8(17)6-12(10)20-13/h1-6,17H,14H2.
What are the key properties of 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol?
2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol has a molecular weight of 287.30 g/mol, XLogP of 3.16, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-3-nitrophenyl)-1,3-benzothiazol-6-ol is sourced from PubChem (CID 102106626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).