C14H17BrO3 — CID 102106709
(2'S,3'aS,8'aS,8'bS)-2'-bromospiro[1,3-dioxolane-2,1'-2,3,3a,6,7,8,8a,8b-octahydrocyclopenta[a]indene]-4'-one (PubChem CID 102106709) has the molecular formula C14H17BrO3 and a molecular weight of 313.19 g/mol. Its IUPAC name is (2'S,3'aS,8'aS,8'bS)-2'-bromospiro[1,3-dioxolane-2,1'-2,3,3a,6,7,8,8a,8b-octahydrocyclopenta[a]indene]-4'-one.
| Compound Name | (2'S,3'aS,8'aS,8'bS)-2'-bromospiro[1,3-dioxolane-2,1'-2,3,3a,6,7,8,8a,8b-octahydrocyclopenta[a]indene]-4'-one |
|---|---|
| PubChem CID | 102106709 |
| Molecular Formula | C14H17BrO3 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (2'S,3'aS,8'aS,8'bS)-2'-bromospiro[1,3-dioxolane-2,1'-2,3,3a,6,7,8,8a,8b-octahydrocyclopenta[a]indene]-4'-one |
| SMILES | O=C1C2=CCCC[C@H]2[C@H]2[C@@H]1C[C@H](Br)C21OCCO1 |
| InChI | InChI=1S/C14H17BrO3/c15-11-7-10-12(14(11)17-5-6-18-14)8-3-1-2-4-9(8)13(10)16/h4,8,10-12H,1-3,5-7H2/t8-,10+,11+,12+/m1/s1 |
| InChIKey | NCCDGIOVIGDBIO-QTKMDUPCSA-N |
| XLogP | 2.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|