About N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide
N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide (PubChem CID 102107436) has the molecular formula C13H27NOS
and a molecular weight of 245.43 g/mol. Its IUPAC name is N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide |
| PubChem CID | 102107436 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide |
| SMILES | C=CCC(C)(CC(C)C)NS(=O)C(C)(C)C |
| InChI | InChI=1S/C13H27NOS/c1-8-9-13(7,10-11(2)3)14-16(15)12(4,5)6/h8,11,14H,1,9-10H2,2-7H3 |
| InChIKey | NACALVBGXUEQGX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide?
The IUPAC name of N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide (CID 102107436) is N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide is C=CCC(C)(CC(C)C)NS(=O)C(C)(C)C.
What is the InChIKey of N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide?
The InChIKey is NACALVBGXUEQGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NOS/c1-8-9-13(7,10-11(2)3)14-16(15)12(4,5)6/h8,11,14H,1,9-10H2,2-7H3.
What are the key properties of N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide?
N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide has a molecular weight of 245.43 g/mol, XLogP of 3.42, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethylhept-1-en-4-yl)-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 102107436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).