C27H20F6N2S2 — CID 102108114
4-[8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(2-methyl-4-pyridinyl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]-2-methylpyridine (PubChem CID 102108114) has the molecular formula C27H20F6N2S2 and a molecular weight of 550.59 g/mol. Its IUPAC name is 4-[8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(2-methyl-4-pyridinyl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]-2-methylpyridine.
| Compound Name | 4-[8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(2-methyl-4-pyridinyl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]-2-methylpyridine |
|---|---|
| PubChem CID | 102108114 |
| Molecular Formula | C27H20F6N2S2 |
| Molecular Weight | 550.59 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | 4-[8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-(2-methyl-4-pyridinyl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl]-2-methylpyridine |
| SMILES | Cc1cc(C2=CC3=C4C(=C5C=C(c6ccnc(C)c6)SC5(C)C3(C)S2)C(F)(F)C(F)(F)C4(F)F)ccn1 |
| InChI | InChI=1S/C27H20F6N2S2/c1-13-9-15(5-7-34-13)19-11-17-21-22(26(30,31)27(32,33)25(21,28)29)18-12-20(16-6-8-35-14(2)10-16)37-24(18,4)23(17,3)36-19/h5-12H,1-4H3 |
| InChIKey | GVRPFDJNNBYSRR-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.59 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|