About 4-(4-fluorophenyl)-1,3-dioxolan-2-one
4-(4-fluorophenyl)-1,3-dioxolan-2-one (PubChem CID 102108256) has the molecular formula C9H7FO3
and a molecular weight of 182.15 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-1,3-dioxolan-2-one |
| PubChem CID | 102108256 |
| Molecular Formula | C9H7FO3 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 4-(4-fluorophenyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C9H7FO3/c10-7-3-1-6(2-4-7)8-5-12-9(11)13-8/h1-4,8H,5H2 |
| InChIKey | POOFIAZVXKKFPW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-fluorophenyl)-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-1,3-dioxolan-2-one?
The IUPAC name of 4-(4-fluorophenyl)-1,3-dioxolan-2-one (CID 102108256) is 4-(4-fluorophenyl)-1,3-dioxolan-2-one.
What is the SMILES notation for 4-(4-fluorophenyl)-1,3-dioxolan-2-one?
The canonical SMILES for 4-(4-fluorophenyl)-1,3-dioxolan-2-one is O=C1OCC(c2ccc(F)cc2)O1.
What is the InChIKey of 4-(4-fluorophenyl)-1,3-dioxolan-2-one?
The InChIKey is POOFIAZVXKKFPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FO3/c10-7-3-1-6(2-4-7)8-5-12-9(11)13-8/h1-4,8H,5H2.
What are the key properties of 4-(4-fluorophenyl)-1,3-dioxolan-2-one?
4-(4-fluorophenyl)-1,3-dioxolan-2-one has a molecular weight of 182.15 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-1,3-dioxolan-2-one is sourced from PubChem (CID 102108256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).