C34H52NO2+ — CID 102108484
(19Z)-10,29-dioxa-3-azoniatricyclo[29.2.2.25,8]heptatriaconta-1(34),5,7,19,31(35),32,36-heptaene (PubChem CID 102108484) has the molecular formula C34H52NO2+ and a molecular weight of 506.80 g/mol. Its IUPAC name is (19Z)-10,29-dioxa-3-azoniatricyclo[29.2.2.25,8]heptatriaconta-1(34),5,7,19,31(35),32,36-heptaene.
| Compound Name | (19Z)-10,29-dioxa-3-azoniatricyclo[29.2.2.25,8]heptatriaconta-1(34),5,7,19,31(35),32,36-heptaene |
|---|---|
| PubChem CID | 102108484 |
| Molecular Formula | C34H52NO2+ |
| Molecular Weight | 506.80 g/mol |
| Exact Mass | 506.40 |
| IUPAC Name | (19Z)-10,29-dioxa-3-azoniatricyclo[29.2.2.25,8]heptatriaconta-1(34),5,7,19,31(35),32,36-heptaene |
| SMILES | C1=C\CCCCCCCCOCc2ccc(cc2)C[NH2+]Cc2ccc(cc2)COCCCCCCCC/1 |
| InChI | InChI=1S/C34H51NO2/c1-2-4-6-8-10-12-14-16-26-37-30-34-23-19-32(20-24-34)28-35-27-31-17-21-33(22-18-31)29-36-25-15-13-11-9-7-5-3-1/h1-2,17-24,35H,3-16,25-30H2/p+1/b2-1- |
| InChIKey | MGVQDZJOACCXHY-UPHRSURJSA-O |
| XLogP | 8.01 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.80 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|