C17H22O5 — CID 102108596
dimethyl (4aS,7aS,7bR)-3,7b-dimethyl-4-oxo-1,2,4a,5,7,7a-hexahydrocyclobuta[e]indene-6,6-dicarboxylate (PubChem CID 102108596) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is dimethyl (4aS,7aS,7bR)-3,7b-dimethyl-4-oxo-1,2,4a,5,7,7a-hexahydrocyclobuta[e]indene-6,6-dicarboxylate.
| Compound Name | dimethyl (4aS,7aS,7bR)-3,7b-dimethyl-4-oxo-1,2,4a,5,7,7a-hexahydrocyclobuta[e]indene-6,6-dicarboxylate |
|---|---|
| PubChem CID | 102108596 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | dimethyl (4aS,7aS,7bR)-3,7b-dimethyl-4-oxo-1,2,4a,5,7,7a-hexahydrocyclobuta[e]indene-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H]2C(=O)C(C)=C3CC[C@]3(C)[C@H]2C1 |
| InChI | InChI=1S/C17H22O5/c1-9-11-5-6-16(11,2)12-8-17(14(19)21-3,15(20)22-4)7-10(12)13(9)18/h10,12H,5-8H2,1-4H3/t10-,12-,16-/m0/s1 |
| InChIKey | GIAXVWJRTZSMMK-PKWAYOAASA-N |
| XLogP | 2.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|