C13H12F7NO — CID 102109187
2-methyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pentanamide (PubChem CID 102109187) has the molecular formula C13H12F7NO and a molecular weight of 331.23 g/mol. Its IUPAC name is 2-methyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | 2-methyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 102109187 |
| Molecular Formula | C13H12F7NO |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-methyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]pentanamide |
| SMILES | CCCC(C)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C13H12F7NO/c1-3-4-5(2)12(22)21-11-9(16)7(14)6(13(18,19)20)8(15)10(11)17/h5H,3-4H2,1-2H3,(H,21,22) |
| InChIKey | YNVQSVOQIMMUIQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|