C9H14O2 — CID 102109582
(3R,4R)-3-prop-1-en-2-yloxane-4-carbaldehyde (PubChem CID 102109582) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (3R,4R)-3-prop-1-en-2-yloxane-4-carbaldehyde.
| Compound Name | (3R,4R)-3-prop-1-en-2-yloxane-4-carbaldehyde |
|---|---|
| PubChem CID | 102109582 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (3R,4R)-3-prop-1-en-2-yloxane-4-carbaldehyde |
| SMILES | C=C(C)[C@@H]1COCC[C@H]1C=O |
| InChI | InChI=1S/C9H14O2/c1-7(2)9-6-11-4-3-8(9)5-10/h5,8-9H,1,3-4,6H2,2H3/t8-,9-/m0/s1 |
| InChIKey | JOXCACISYTWBKQ-IUCAKERBSA-N |
| XLogP | 1.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|