C22H13NO2S2 — CID 102109911
7,11-dithiophen-2-yl-[1,3]dioxolo[4,5-j]phenanthridine (PubChem CID 102109911) has the molecular formula C22H13NO2S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 7,11-dithiophen-2-yl-[1,3]dioxolo[4,5-j]phenanthridine.
| Compound Name | 7,11-dithiophen-2-yl-[1,3]dioxolo[4,5-j]phenanthridine |
|---|---|
| PubChem CID | 102109911 |
| Molecular Formula | C22H13NO2S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 7,11-dithiophen-2-yl-[1,3]dioxolo[4,5-j]phenanthridine |
| SMILES | c1csc(-c2c3c(c(-c4cccs4)c4c2cnc2ccccc24)OCO3)c1 |
| InChI | InChI=1S/C22H13NO2S2/c1-2-6-15-13(5-1)18-14(11-23-15)19(16-7-3-9-26-16)21-22(25-12-24-21)20(18)17-8-4-10-27-17/h1-11H,12H2 |
| InChIKey | NEJURAAKVNIFPA-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|