C29H25F10NO2 — CID 10210995
(2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol (PubChem CID 10210995) has the molecular formula C29H25F10NO2 and a molecular weight of 609.50 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol |
|---|---|
| PubChem CID | 10210995 |
| Molecular Formula | C29H25F10NO2 |
| Molecular Weight | 609.50 g/mol |
| Exact Mass | 609.17 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-[N-[[3-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)anilino]propan-2-ol |
| SMILES | O[C@H](CN(Cc1cccc(C(F)(F)C(F)(F)C(F)(F)F)c1)c1cccc(Oc2ccc3c(c2)CCCC3)c1)C(F)(F)F |
| InChI | InChI=1S/C29H25F10NO2/c30-26(31,28(35,36)29(37,38)39)21-8-3-5-18(13-21)16-40(17-25(41)27(32,33)34)22-9-4-10-23(15-22)42-24-12-11-19-6-1-2-7-20(19)14-24/h3-5,8-15,25,41H,1-2,6-7,16-17H2/t25-/m1/s1 |
| InChIKey | GZBPYOXWXVPULN-RUZDIDTESA-N |
| XLogP | 8.58 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.50 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|