C14H16N2O6S2 — CID 102110343
(3S,4R,5S)-5-[4-[(2R,3S,4R)-4-hydroxy-3-nitrothiolan-2-yl]phenyl]-4-nitrothiolan-3-ol (PubChem CID 102110343) has the molecular formula C14H16N2O6S2 and a molecular weight of 372.42 g/mol. Its IUPAC name is (3S,4R,5S)-5-[4-[(2R,3S,4R)-4-hydroxy-3-nitrothiolan-2-yl]phenyl]-4-nitrothiolan-3-ol.
| Compound Name | (3S,4R,5S)-5-[4-[(2R,3S,4R)-4-hydroxy-3-nitrothiolan-2-yl]phenyl]-4-nitrothiolan-3-ol |
|---|---|
| PubChem CID | 102110343 |
| Molecular Formula | C14H16N2O6S2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | (3S,4R,5S)-5-[4-[(2R,3S,4R)-4-hydroxy-3-nitrothiolan-2-yl]phenyl]-4-nitrothiolan-3-ol |
| SMILES | O=[N+]([O-])[C@@H]1[C@@H](c2ccc([C@@H]3SC[C@@H](O)[C@H]3[N+](=O)[O-])cc2)SC[C@@H]1O |
| InChI | InChI=1S/C14H16N2O6S2/c17-9-5-23-13(11(9)15(19)20)7-1-2-8(4-3-7)14-12(16(21)22)10(18)6-24-14/h1-4,9-14,17-18H,5-6H2/t9-,10+,11-,12+,13+,14- |
| InChIKey | ISBXQCBRSUGRIT-QSWPVVRKSA-N |
| XLogP | 1.27 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|