C8H9NO4S — CID 102110345
(3S,4R,5R)-5-(furan-2-yl)-4-nitrothiolan-3-ol (PubChem CID 102110345) has the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. Its IUPAC name is (3S,4R,5R)-5-(furan-2-yl)-4-nitrothiolan-3-ol.
| Compound Name | (3S,4R,5R)-5-(furan-2-yl)-4-nitrothiolan-3-ol |
|---|---|
| PubChem CID | 102110345 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (3S,4R,5R)-5-(furan-2-yl)-4-nitrothiolan-3-ol |
| SMILES | O=[N+]([O-])[C@@H]1[C@H](O)CS[C@H]1c1ccco1 |
| InChI | InChI=1S/C8H9NO4S/c10-5-4-14-8(7(5)9(11)12)6-2-1-3-13-6/h1-3,5,7-8,10H,4H2/t5-,7-,8+/m1/s1 |
| InChIKey | CGTIGXVODHNGOO-NJUXHZRNSA-N |
| XLogP | 1.07 |
| TPSA | 76.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|