C20H40O4Si2 — CID 102110476
2,2,4,4-tetra(propan-2-yl)-8-prop-2-enyl-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine (PubChem CID 102110476) has the molecular formula C20H40O4Si2 and a molecular weight of 400.71 g/mol. Its IUPAC name is 2,2,4,4-tetra(propan-2-yl)-8-prop-2-enyl-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine.
| Compound Name | 2,2,4,4-tetra(propan-2-yl)-8-prop-2-enyl-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine |
|---|---|
| PubChem CID | 102110476 |
| Molecular Formula | C20H40O4Si2 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2,2,4,4-tetra(propan-2-yl)-8-prop-2-enyl-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocine |
| SMILES | C=CCC1CC2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)OCC2O1 |
| InChI | InChI=1S/C20H40O4Si2/c1-10-11-18-12-19-20(22-18)13-21-25(14(2)3,15(4)5)24-26(23-19,16(6)7)17(8)9/h10,14-20H,1,11-13H2,2-9H3 |
| InChIKey | YAMAOGFNXRNCKM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|