C25H21BrN4O4 — CID 102110567
8-bromo-1,3-bis[(4-methoxyphenyl)methyl]purino[9,8-a]pyridine-2,4-dione (PubChem CID 102110567) has the molecular formula C25H21BrN4O4 and a molecular weight of 521.37 g/mol. Its IUPAC name is 8-bromo-1,3-bis[(4-methoxyphenyl)methyl]purino[9,8-a]pyridine-2,4-dione.
| Compound Name | 8-bromo-1,3-bis[(4-methoxyphenyl)methyl]purino[9,8-a]pyridine-2,4-dione |
|---|---|
| PubChem CID | 102110567 |
| Molecular Formula | C25H21BrN4O4 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 8-bromo-1,3-bis[(4-methoxyphenyl)methyl]purino[9,8-a]pyridine-2,4-dione |
| SMILES | COc1ccc(Cn2c(=O)c3nc4ccc(Br)cn4c3n(Cc3ccc(OC)cc3)c2=O)cc1 |
| InChI | InChI=1S/C25H21BrN4O4/c1-33-19-8-3-16(4-9-19)13-29-23-22(27-21-12-7-18(26)15-28(21)23)24(31)30(25(29)32)14-17-5-10-20(34-2)11-6-17/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | BYLNUTSJVWKOCV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |