C30H40N2O2S3 — CID 102110695
5,6-dioctoxy-4,7-dithiophen-2-yl-2,1,3-benzothiadiazole (PubChem CID 102110695) has the molecular formula C30H40N2O2S3 and a molecular weight of 556.86 g/mol. Its IUPAC name is 5,6-dioctoxy-4,7-dithiophen-2-yl-2,1,3-benzothiadiazole.
| Compound Name | 5,6-dioctoxy-4,7-dithiophen-2-yl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 102110695 |
| Molecular Formula | C30H40N2O2S3 |
| Molecular Weight | 556.86 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 5,6-dioctoxy-4,7-dithiophen-2-yl-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCOc1c(OCCCCCCCC)c(-c2cccs2)c2nsnc2c1-c1cccs1 |
| InChI | InChI=1S/C30H40N2O2S3/c1-3-5-7-9-11-13-19-33-29-25(23-17-15-21-35-23)27-28(32-37-31-27)26(24-18-16-22-36-24)30(29)34-20-14-12-10-8-6-4-2/h15-18,21-22H,3-14,19-20H2,1-2H3 |
| InChIKey | OFASHBNFIJSKDJ-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.86 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|