C26H23NO5S — CID 102110708
2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl 3-(9H-fluoren-9-ylsulfanyl)propanoate (PubChem CID 102110708) has the molecular formula C26H23NO5S and a molecular weight of 461.54 g/mol. Its IUPAC name is 2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl 3-(9H-fluoren-9-ylsulfanyl)propanoate.
| Compound Name | 2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl 3-(9H-fluoren-9-ylsulfanyl)propanoate |
|---|---|
| PubChem CID | 102110708 |
| Molecular Formula | C26H23NO5S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 2-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]ethyl 3-(9H-fluoren-9-ylsulfanyl)propanoate |
| SMILES | O=C(CCSC1c2ccccc2-c2ccccc21)OCCN1C(=O)[C@@H]2C3C=CC(O3)[C@@H]2C1=O |
| InChI | InChI=1S/C26H23NO5S/c28-21(31-13-12-27-25(29)22-19-9-10-20(32-19)23(22)26(27)30)11-14-33-24-17-7-3-1-5-15(17)16-6-2-4-8-18(16)24/h1-10,19-20,22-24H,11-14H2/t19?,20?,22-,23+ |
| InChIKey | LTFWLKAPVSOURX-GUWUJDOSSA-N |
| XLogP | 3.36 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|