About 1-bromo-2-(2,2-difluoroethenyl)benzene
1-bromo-2-(2,2-difluoroethenyl)benzene (PubChem CID 102110855) has the molecular formula C8H5BrF2
and a molecular weight of 219.03 g/mol. Its IUPAC name is 1-bromo-2-(2,2-difluoroethenyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-2-(2,2-difluoroethenyl)benzene |
| PubChem CID | 102110855 |
| Molecular Formula | C8H5BrF2 |
| Molecular Weight | 219.03 g/mol |
| Exact Mass | 217.95 |
| IUPAC Name | 1-bromo-2-(2,2-difluoroethenyl)benzene |
| SMILES | FC(F)=Cc1ccccc1Br |
| InChI | InChI=1S/C8H5BrF2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-5H |
| InChIKey | GVKCFQKMVJSPNR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.03 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-2-(2,2-difluoroethenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-(2,2-difluoroethenyl)benzene?
The IUPAC name of 1-bromo-2-(2,2-difluoroethenyl)benzene (CID 102110855) is 1-bromo-2-(2,2-difluoroethenyl)benzene.
What is the SMILES notation for 1-bromo-2-(2,2-difluoroethenyl)benzene?
The canonical SMILES for 1-bromo-2-(2,2-difluoroethenyl)benzene is FC(F)=Cc1ccccc1Br.
What is the InChIKey of 1-bromo-2-(2,2-difluoroethenyl)benzene?
The InChIKey is GVKCFQKMVJSPNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrF2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-5H.
What are the key properties of 1-bromo-2-(2,2-difluoroethenyl)benzene?
1-bromo-2-(2,2-difluoroethenyl)benzene has a molecular weight of 219.03 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-(2,2-difluoroethenyl)benzene is sourced from PubChem (CID 102110855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).