C11H5F7O3 — CID 102111028
3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-hydroxy-2-benzofuran-1-one (PubChem CID 102111028) has the molecular formula C11H5F7O3 and a molecular weight of 318.14 g/mol. Its IUPAC name is 3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-hydroxy-2-benzofuran-1-one.
| Compound Name | 3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-hydroxy-2-benzofuran-1-one |
|---|---|
| PubChem CID | 102111028 |
| Molecular Formula | C11H5F7O3 |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-hydroxy-2-benzofuran-1-one |
| SMILES | O=C1OC(O)(C(F)(C(F)(F)F)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C11H5F7O3/c12-9(10(13,14)15,11(16,17)18)8(20)6-4-2-1-3-5(6)7(19)21-8/h1-4,20H |
| InChIKey | RFAYWALVDRHSAX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |