C31H16N2O5 — CID 102111251
7-(4-hydroxyphenyl)-18-methyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone (PubChem CID 102111251) has the molecular formula C31H16N2O5 and a molecular weight of 496.48 g/mol. Its IUPAC name is 7-(4-hydroxyphenyl)-18-methyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone.
| Compound Name | 7-(4-hydroxyphenyl)-18-methyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 102111251 |
| Molecular Formula | C31H16N2O5 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 7-(4-hydroxyphenyl)-18-methyl-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| SMILES | CN1C(=O)c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C1=O)c64)C(=O)N(c1ccc(O)cc1)C5=O |
| InChI | InChI=1S/C31H16N2O5/c1-32-28(35)20-10-6-16-18-8-12-22-27-23(31(38)33(30(22)37)14-2-4-15(34)5-3-14)13-9-19(25(18)27)17-7-11-21(29(32)36)26(20)24(16)17/h2-13,34H,1H3 |
| InChIKey | QYWZSOBUIAQTDA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|