C29H17F9N2O — CID 102111611
5-[4-[[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]methoxy]phenyl]-1,10-phenanthroline (PubChem CID 102111611) has the molecular formula C29H17F9N2O and a molecular weight of 580.45 g/mol. Its IUPAC name is 5-[4-[[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]methoxy]phenyl]-1,10-phenanthroline.
| Compound Name | 5-[4-[[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]methoxy]phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 102111611 |
| Molecular Formula | C29H17F9N2O |
| Molecular Weight | 580.45 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | 5-[4-[[4-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]methoxy]phenyl]-1,10-phenanthroline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccc(COc2ccc(-c3cc4cccnc4c4ncccc34)cc2)cc1 |
| InChI | InChI=1S/C29H17F9N2O/c30-26(31,27(32,33)28(34,35)29(36,37)38)20-9-5-17(6-10-20)16-41-21-11-7-18(8-12-21)23-15-19-3-1-13-39-24(19)25-22(23)4-2-14-40-25/h1-15H,16H2 |
| InChIKey | PCRYMQQWERGHRI-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.45 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|