About CID 102111627
CID 102111627 (PubChem CID 102111627) has the molecular formula C14H23O3
and a molecular weight of 239.33 g/mol.
Molecular Properties
| Compound Name | CID 102111627 |
| PubChem CID | 102111627 |
| Molecular Formula | C14H23O3 |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | — |
| SMILES | CC(=O)CCC1C(=O)[C@H]([C@@H](C)[CH]O)CC[C@H]1C |
| InChI | InChI=1S/C14H23O3/c1-9-4-6-13(10(2)8-15)14(17)12(9)7-5-11(3)16/h8-10,12-13,15H,4-7H2,1-3H3/t9-,10+,12?,13+/m1/s1 |
| InChIKey | GTIAJHQMZBDSLT-KYDPMBILSA-N |
| XLogP | 2.76 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 102111627 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102111627?
The IUPAC name of CID 102111627 (CID 102111627) is not available.
What is the SMILES notation for CID 102111627?
The canonical SMILES for CID 102111627 is CC(=O)CCC1C(=O)[C@H]([C@@H](C)[CH]O)CC[C@H]1C.
What is the InChIKey of CID 102111627?
The InChIKey is GTIAJHQMZBDSLT-KYDPMBILSA-N. The full InChI is InChI=1S/C14H23O3/c1-9-4-6-13(10(2)8-15)14(17)12(9)7-5-11(3)16/h8-10,12-13,15H,4-7H2,1-3H3/t9-,10+,12?,13+/m1/s1.
What are the key properties of CID 102111627?
CID 102111627 has a molecular weight of 239.33 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102111627 is sourced from PubChem (CID 102111627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).