C27H28O5 — CID 102111758
3-hexyl-5-methyl-11-propan-2-yloxynaphtho[2,3-h]chromene-2,7,12-trione (PubChem CID 102111758) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-hexyl-5-methyl-11-propan-2-yloxynaphtho[2,3-h]chromene-2,7,12-trione.
| Compound Name | 3-hexyl-5-methyl-11-propan-2-yloxynaphtho[2,3-h]chromene-2,7,12-trione |
|---|---|
| PubChem CID | 102111758 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 3-hexyl-5-methyl-11-propan-2-yloxynaphtho[2,3-h]chromene-2,7,12-trione |
| SMILES | CCCCCCc1cc2c(C)cc3c(c2oc1=O)C(=O)c1c(OC(C)C)cccc1C3=O |
| InChI | InChI=1S/C27H28O5/c1-5-6-7-8-10-17-14-19-16(4)13-20-23(26(19)32-27(17)30)25(29)22-18(24(20)28)11-9-12-21(22)31-15(2)3/h9,11-15H,5-8,10H2,1-4H3 |
| InChIKey | UBHSSEYMFOLXCD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|