C26H44B3NO6 — CID 102111814
4-methyl-2-[2,2,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyridine (PubChem CID 102111814) has the molecular formula C26H44B3NO6 and a molecular weight of 499.08 g/mol. Its IUPAC name is 4-methyl-2-[2,2,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyridine.
| Compound Name | 4-methyl-2-[2,2,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyridine |
|---|---|
| PubChem CID | 102111814 |
| Molecular Formula | C26H44B3NO6 |
| Molecular Weight | 499.08 g/mol |
| Exact Mass | 499.34 |
| IUPAC Name | 4-methyl-2-[2,2,2-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethyl]pyridine |
| SMILES | Cc1ccnc(CC(B2OC(C)(C)C(C)(C)O2)(B2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C26H44B3NO6/c1-18-14-15-30-19(16-18)17-26(27-31-20(2,3)21(4,5)32-27,28-33-22(6,7)23(8,9)34-28)29-35-24(10,11)25(12,13)36-29/h14-16H,17H2,1-13H3 |
| InChIKey | DOVQCEWRAZTUJB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 68.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.08 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|